jtkgotosleep123
jtkgotosleep123 jtkgotosleep123
  • 01-12-2020
  • Mathematics
contestada

what is the exact value of cos(11pi/21)cos(pi/7)-sin(11pi/21)sin(pi/7)?

a. -squr3/2
b. -1/2
c. 1/2
d. squr3/2​

Respuesta :

funnymunchies2004
funnymunchies2004 funnymunchies2004
  • 07-12-2020

Answer:

B

Step-by-step explanation:

-1/2

Answer Link
camjjwo camjjwo
  • 12-06-2021

Answer:

B -1/2

Step-by-step explanation:

Answer Link

Otras preguntas

Find the value of x.  Round to nearest hundredth if necessary.
If a slope of a line is 2/0 is it 0 or undefined?
How do scientists use seismic waves to determine the interior structure of Earth?
Determine whether the sequence coverage or diverges. If it converges, give the limit. 48, 8, 4/3, 2/9, ...
Does every point lie in a quadrant?
How did scientists discover the common structure of cells?
which seismic wave moves through earth at the fastest speed?
Explain how a species can evolve through natural selection.
5x+4y+100 in slope intercept form
Which of the kingdoms has the smallest number of known species